C15H15FN2O — CID 82345565
4-[(3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine (PubChem CID 82345565) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine.
| Compound Name | 4-[(3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine |
|---|---|
| PubChem CID | 82345565 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine |
| SMILES | Nc1cccc2c1N(Cc1cccc(F)c1)CCO2 |
| InChI | InChI=1S/C15H15FN2O/c16-12-4-1-3-11(9-12)10-18-7-8-19-14-6-2-5-13(17)15(14)18/h1-6,9H,7-8,10,17H2 |
| InChIKey | SDXRNLVUELEHKX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|