C15H15ClN2O — CID 82345504
4-[(2-chlorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine (PubChem CID 82345504) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine |
|---|---|
| PubChem CID | 82345504 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2,3-dihydro-1,4-benzoxazin-5-amine |
| SMILES | Nc1cccc2c1N(Cc1ccccc1Cl)CCO2 |
| InChI | InChI=1S/C15H15ClN2O/c16-12-5-2-1-4-11(12)10-18-8-9-19-14-7-3-6-13(17)15(14)18/h1-7H,8-10,17H2 |
| InChIKey | MWQBYHZZPGJECO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|