C14H15FN2O4 — CID 82346606
4-[4-(3-fluorophenyl)-2,6-dioxopiperazin-1-yl]butanoic acid (PubChem CID 82346606) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 4-[4-(3-fluorophenyl)-2,6-dioxopiperazin-1-yl]butanoic acid.
| Compound Name | 4-[4-(3-fluorophenyl)-2,6-dioxopiperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 82346606 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[4-(3-fluorophenyl)-2,6-dioxopiperazin-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)CN(c2cccc(F)c2)CC1=O |
| InChI | InChI=1S/C14H15FN2O4/c15-10-3-1-4-11(7-10)16-8-12(18)17(13(19)9-16)6-2-5-14(20)21/h1,3-4,7H,2,5-6,8-9H2,(H,20,21) |
| InChIKey | MYKLWIHPPIBIOM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|