C12H11FN2O4 — CID 82346522
2-[4-(4-fluorophenyl)-2,6-dioxopiperazin-1-yl]acetic acid (PubChem CID 82346522) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2,6-dioxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(4-fluorophenyl)-2,6-dioxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 82346522 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2,6-dioxopiperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)CN(c2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C12H11FN2O4/c13-8-1-3-9(4-2-8)14-5-10(16)15(7-12(18)19)11(17)6-14/h1-4H,5-7H2,(H,18,19) |
| InChIKey | WHNJCCKSJJBQIT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|