methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate

C15H23NO3 — CID 82351560

IUPACmethyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate
SMILESCNC(CC(=O)OC)Cc1c(C)cc(OC)cc1C
InChIInChI=1S/C15H23NO3/c1-10-6-13(18-4)7-11(2)14(10)8-12(16-3)9-15(17)19-5/h6-7,12,16H,8-9H2,1-5H3
InChIKeyDYMNPBMAZAEMPR-UHFFFAOYSA-N
MW265.35 g/mol
LogP2.01
Rot. Bonds6

About methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate

methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate (PubChem CID 82351560) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate.

Molecular Properties

Compound Namemethyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate
PubChem CID82351560
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Namemethyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate
SMILESCNC(CC(=O)OC)Cc1c(C)cc(OC)cc1C
InChIInChI=1S/C15H23NO3/c1-10-6-13(18-4)7-11(2)14(10)8-12(16-3)9-15(17)19-5/h6-7,12,16H,8-9H2,1-5H3
InChIKeyDYMNPBMAZAEMPR-UHFFFAOYSA-N
XLogP2.01
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate?
The IUPAC name of methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate (CID 82351560) is methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate.
What is the SMILES notation for methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate?
The canonical SMILES for methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate is CNC(CC(=O)OC)Cc1c(C)cc(OC)cc1C.
What is the InChIKey of methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate?
The InChIKey is DYMNPBMAZAEMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-10-6-13(18-4)7-11(2)14(10)8-12(16-3)9-15(17)19-5/h6-7,12,16H,8-9H2,1-5H3.
What are the key properties of methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate?
methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate has a molecular weight of 265.35 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-methoxy-2,6-dimethylphenyl)-3-(methylamino)butanoate is sourced from PubChem (CID 82351560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).