C17H26FNO2 — CID 82351859
ethyl 3-(butylamino)-4-(4-fluoro-3-methylphenyl)butanoate (PubChem CID 82351859) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl 3-(butylamino)-4-(4-fluoro-3-methylphenyl)butanoate.
| Compound Name | ethyl 3-(butylamino)-4-(4-fluoro-3-methylphenyl)butanoate |
|---|---|
| PubChem CID | 82351859 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | ethyl 3-(butylamino)-4-(4-fluoro-3-methylphenyl)butanoate |
| SMILES | CCCCNC(CC(=O)OCC)Cc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C17H26FNO2/c1-4-6-9-19-15(12-17(20)21-5-2)11-14-7-8-16(18)13(3)10-14/h7-8,10,15,19H,4-6,9,11-12H2,1-3H3 |
| InChIKey | OOTGTDHEODUCTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|