C12H16N2O5S — CID 82355158
2-ethyl-N-(2-hydroxyethyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 82355158) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-ethyl-N-(2-hydroxyethyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | 2-ethyl-N-(2-hydroxyethyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 82355158 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-ethyl-N-(2-hydroxyethyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CCC1Oc2ccc(S(=O)(=O)NCCO)cc2NC1=O |
| InChI | InChI=1S/C12H16N2O5S/c1-2-10-12(16)14-9-7-8(3-4-11(9)19-10)20(17,18)13-5-6-15/h3-4,7,10,13,15H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | MVGOGLFFYPVGOW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |