C13H18N2O4S — CID 82355180
N-ethyl-3-oxo-2-propan-2-yl-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 82355180) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-ethyl-3-oxo-2-propan-2-yl-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-ethyl-3-oxo-2-propan-2-yl-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 82355180 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-ethyl-3-oxo-2-propan-2-yl-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc2c(c1)NC(=O)C(C(C)C)O2 |
| InChI | InChI=1S/C13H18N2O4S/c1-4-14-20(17,18)9-5-6-11-10(7-9)15-13(16)12(19-11)8(2)3/h5-8,12,14H,4H2,1-3H3,(H,15,16) |
| InChIKey | VXXMVDUWWJDIOI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |