C10H12N2O4S — CID 82355229
N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 82355229) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 82355229 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C10H12N2O4S/c1-6-10(13)12-8-5-7(17(14,15)11-2)3-4-9(8)16-6/h3-6,11H,1-2H3,(H,12,13) |
| InChIKey | WQCIWSAAENSKJC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |