C12H15NO4S — CID 82233482
2-methyl-6-propylsulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 82233482) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-methyl-6-propylsulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-6-propylsulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82233482 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-methyl-6-propylsulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCCS(=O)(=O)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C12H15NO4S/c1-3-6-18(15,16)9-4-5-11-10(7-9)13-12(14)8(2)17-11/h4-5,7-8H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | QKTYPEWPJFETMM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |