C16H16N2O4S — CID 110783688
N-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide (PubChem CID 110783688) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide.
| Compound Name | N-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110783688 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]benzenesulfonamide |
| SMILES | CC1Oc2ccc(CNS(=O)(=O)c3ccccc3)cc2NC1=O |
| InChI | InChI=1S/C16H16N2O4S/c1-11-16(19)18-14-9-12(7-8-15(14)22-11)10-17-23(20,21)13-5-3-2-4-6-13/h2-9,11,17H,10H2,1H3,(H,18,19) |
| InChIKey | GQQIEAOSXPTXHT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |