C15H12N4O3 — CID 82355527
3-[(3-hydroxyphenyl)diazenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 82355527) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 3-[(3-hydroxyphenyl)diazenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxylic acid.
| Compound Name | 3-[(3-hydroxyphenyl)diazenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 82355527 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[(3-hydroxyphenyl)diazenyl]-7-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | Cc1ccn2c(/N=N/c3cccc(O)c3)c(C(=O)O)nc2c1 |
| InChI | InChI=1S/C15H12N4O3/c1-9-5-6-19-12(7-9)16-13(15(21)22)14(19)18-17-10-3-2-4-11(20)8-10/h2-8,20H,1H3,(H,21,22)/b18-17+ |
| InChIKey | KDLRPVJWEPVAMQ-ISLYRVAYSA-N |
| XLogP | 3.46 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|