C16H14N4O2 — CID 82355477
3-[(2,6-dimethylphenyl)diazenyl]imidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 82355477) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)diazenyl]imidazo[1,2-a]pyridine-2-carboxylic acid.
| Compound Name | 3-[(2,6-dimethylphenyl)diazenyl]imidazo[1,2-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 82355477 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)diazenyl]imidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1/N=N/c1c(C(=O)O)nc2ccccn12 |
| InChI | InChI=1S/C16H14N4O2/c1-10-6-5-7-11(2)13(10)18-19-15-14(16(21)22)17-12-8-3-4-9-20(12)15/h3-9H,1-2H3,(H,21,22)/b19-18+ |
| InChIKey | GTBOMYBEPRDSJI-VHEBQXMUSA-N |
| XLogP | 4.06 |
| TPSA | 79.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|