C16H16N4O — CID 82355705
3-[(2,6-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-8-ol (PubChem CID 82355705) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-8-ol.
| Compound Name | 3-[(2,6-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 82355705 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)diazenyl]-2-methylimidazo[1,2-a]pyridin-8-ol |
| SMILES | Cc1cccc(C)c1/N=N/c1c(C)nc2c(O)cccn12 |
| InChI | InChI=1S/C16H16N4O/c1-10-6-4-7-11(2)14(10)18-19-15-12(3)17-16-13(21)8-5-9-20(15)16/h4-9,21H,1-3H3/b19-18+ |
| InChIKey | NSRLNFHYUGAVNQ-VHEBQXMUSA-N |
| XLogP | 4.38 |
| TPSA | 62.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|