About 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite
2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite (PubChem CID 143197131) has the molecular formula C11H11FN2O3
and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite.
Molecular Properties
| Compound Name | 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite |
| PubChem CID | 143197131 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite |
| SMILES | Cc1nc2c(O)cccn2c(=O)c1CCOF |
| InChI | InChI=1S/C11H11FN2O3/c1-7-8(4-6-17-12)11(16)14-5-2-3-9(15)10(14)13-7/h2-3,5,15H,4,6H2,1H3 |
| InChIKey | IMOOMYURUHHMFO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite?
The IUPAC name of 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite (CID 143197131) is 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite.
What is the SMILES notation for 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite?
The canonical SMILES for 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite is Cc1nc2c(O)cccn2c(=O)c1CCOF.
What is the InChIKey of 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite?
The InChIKey is IMOOMYURUHHMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O3/c1-7-8(4-6-17-12)11(16)14-5-2-3-9(15)10(14)13-7/h2-3,5,15H,4,6H2,1H3.
What are the key properties of 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite?
2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite has a molecular weight of 238.22 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-hydroxy-2-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)ethyl hypofluorite is sourced from PubChem (CID 143197131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).