About 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid
9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid (PubChem CID 46851352) has the molecular formula C11H14N2O7S
and a molecular weight of 318.31 g/mol. Its IUPAC name is 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid.
Molecular Properties
| Compound Name | 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid |
| PubChem CID | 46851352 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid |
| SMILES | Cc1nc2c(O)cccn2c(=O)c1CCO.O=S(=O)(O)O |
| InChI | InChI=1S/C11H12N2O3.H2O4S/c1-7-8(4-6-14)11(16)13-5-2-3-9(15)10(13)12-7;1-5(2,3)4/h2-3,5,14-15H,4,6H2,1H3;(H2,1,2,3,4) |
| InChIKey | DLASVPOVZUPNJP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid?
The IUPAC name of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid (CID 46851352) is 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid.
What is the SMILES notation for 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid?
The canonical SMILES for 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid is Cc1nc2c(O)cccn2c(=O)c1CCO.O=S(=O)(O)O.
What is the InChIKey of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid?
The InChIKey is DLASVPOVZUPNJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3.H2O4S/c1-7-8(4-6-14)11(16)13-5-2-3-9(15)10(13)12-7;1-5(2,3)4/h2-3,5,14-15H,4,6H2,1H3;(H2,1,2,3,4).
What are the key properties of 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid?
9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid has a molecular weight of 318.31 g/mol, XLogP of -0.41, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one;sulfuric acid is sourced from PubChem (CID 46851352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).