C14H10F2N2O — CID 82357063
[2-(2,5-difluorophenyl)imidazo[1,2-a]pyridin-7-yl]methanol (PubChem CID 82357063) has the molecular formula C14H10F2N2O and a molecular weight of 260.24 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)imidazo[1,2-a]pyridin-7-yl]methanol.
| Compound Name | [2-(2,5-difluorophenyl)imidazo[1,2-a]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 82357063 |
| Molecular Formula | C14H10F2N2O |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | [2-(2,5-difluorophenyl)imidazo[1,2-a]pyridin-7-yl]methanol |
| SMILES | OCc1ccn2cc(-c3cc(F)ccc3F)nc2c1 |
| InChI | InChI=1S/C14H10F2N2O/c15-10-1-2-12(16)11(6-10)13-7-18-4-3-9(8-19)5-14(18)17-13/h1-7,19H,8H2 |
| InChIKey | IPBMHGPHTMWYDT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |