C15H13NO3 — CID 82357792
[2-(phenoxymethyl)-1,3-benzoxazol-6-yl]methanol (PubChem CID 82357792) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is [2-(phenoxymethyl)-1,3-benzoxazol-6-yl]methanol.
| Compound Name | [2-(phenoxymethyl)-1,3-benzoxazol-6-yl]methanol |
|---|---|
| PubChem CID | 82357792 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [2-(phenoxymethyl)-1,3-benzoxazol-6-yl]methanol |
| SMILES | OCc1ccc2nc(COc3ccccc3)oc2c1 |
| InChI | InChI=1S/C15H13NO3/c17-9-11-6-7-13-14(8-11)19-15(16-13)10-18-12-4-2-1-3-5-12/h1-8,17H,9-10H2 |
| InChIKey | HWYOFIBJHZKXKE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |