C10H9N5O4 — CID 82358258
2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 82358258) has the molecular formula C10H9N5O4 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 82358258 |
| Molecular Formula | C10H9N5O4 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | Nc1nonc1CC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9N5O4/c11-10-8(13-19-14-10)5-9(16)12-6-2-1-3-7(4-6)15(17)18/h1-4H,5H2,(H2,11,14)(H,12,16) |
| InChIKey | RDCZBSMACCKWCQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|