C14H25N3O — CID 82358707
2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclohexylacetamide (PubChem CID 82358707) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 82358707 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-[6-(aminomethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclohexylacetamide |
| SMILES | NCC1C=CCCN1CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H25N3O/c15-10-13-8-4-5-9-17(13)11-14(18)16-12-6-2-1-3-7-12/h4,8,12-13H,1-3,5-7,9-11,15H2,(H,16,18) |
| InChIKey | GREKMNJCFXKUSH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|