C17H19N3 — CID 82359041
5,6-dimethyl-1-(1-phenylethyl)benzimidazol-2-amine (PubChem CID 82359041) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 5,6-dimethyl-1-(1-phenylethyl)benzimidazol-2-amine.
| Compound Name | 5,6-dimethyl-1-(1-phenylethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 82359041 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 5,6-dimethyl-1-(1-phenylethyl)benzimidazol-2-amine |
| SMILES | Cc1cc2nc(N)n(C(C)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C17H19N3/c1-11-9-15-16(10-12(11)2)20(17(18)19-15)13(3)14-7-5-4-6-8-14/h4-10,13H,1-3H3,(H2,18,19) |
| InChIKey | NONZEWAZQMESME-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |