C16H14N2O3 — CID 82361473
1-(3,4-dimethylphenyl)-5-(furan-2-yl)pyrazole-4-carboxylic acid (PubChem CID 82361473) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-(furan-2-yl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(3,4-dimethylphenyl)-5-(furan-2-yl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82361473 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-(furan-2-yl)pyrazole-4-carboxylic acid |
| SMILES | Cc1ccc(-n2ncc(C(=O)O)c2-c2ccco2)cc1C |
| InChI | InChI=1S/C16H14N2O3/c1-10-5-6-12(8-11(10)2)18-15(14-4-3-7-21-14)13(9-17-18)16(19)20/h3-9H,1-2H3,(H,19,20) |
| InChIKey | AGTYJONROJVANH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |