C13H12ClNO2 — CID 82362498
1-(5-chloro-2-methylphenyl)-2-methylpyrrole-3-carboxylic acid (PubChem CID 82362498) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2-methylpyrrole-3-carboxylic acid.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82362498 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2-methylpyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(Cl)cc1-n1ccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H12ClNO2/c1-8-3-4-10(14)7-12(8)15-6-5-11(9(15)2)13(16)17/h3-7H,1-2H3,(H,16,17) |
| InChIKey | XQXMHJQVZRYYFX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |