C16H21NO3 — CID 82363007
N,N-diethyl-2-[4-(1-hydroxybut-3-ynyl)phenoxy]acetamide (PubChem CID 82363007) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(1-hydroxybut-3-ynyl)phenoxy]acetamide.
| Compound Name | N,N-diethyl-2-[4-(1-hydroxybut-3-ynyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 82363007 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N,N-diethyl-2-[4-(1-hydroxybut-3-ynyl)phenoxy]acetamide |
| SMILES | C#CCC(O)c1ccc(OCC(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-4-7-15(18)13-8-10-14(11-9-13)20-12-16(19)17(5-2)6-3/h1,8-11,15,18H,5-7,12H2,2-3H3 |
| InChIKey | LRZLIROSKBIWOR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|