C15H16ClNO2 — CID 82363967
2-[2-(4-chlorophenyl)-4-methylpyrrol-1-yl]butanoic acid (PubChem CID 82363967) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-4-methylpyrrol-1-yl]butanoic acid.
| Compound Name | 2-[2-(4-chlorophenyl)-4-methylpyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 82363967 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-4-methylpyrrol-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1cc(C)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClNO2/c1-3-13(15(18)19)17-9-10(2)8-14(17)11-4-6-12(16)7-5-11/h4-9,13H,3H2,1-2H3,(H,18,19) |
| InChIKey | YFMVOLSWYLVXNV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |