C15H15N3O2S — CID 82367473
N-[4-(5-formyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]propanamide (PubChem CID 82367473) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[4-(5-formyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]propanamide.
| Compound Name | N-[4-(5-formyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 82367473 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[4-(5-formyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(-c2nc3n(c2C=O)CCS3)cc1 |
| InChI | InChI=1S/C15H15N3O2S/c1-2-13(20)16-11-5-3-10(4-6-11)14-12(9-19)18-7-8-21-15(18)17-14/h3-6,9H,2,7-8H2,1H3,(H,16,20) |
| InChIKey | FIRZGSAGQBHVHH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|