C20H14N4OS — CID 82367751
6-(1-methylbenzimidazol-5-yl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 82367751) has the molecular formula C20H14N4OS and a molecular weight of 358.43 g/mol. Its IUPAC name is 6-(1-methylbenzimidazol-5-yl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(1-methylbenzimidazol-5-yl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82367751 |
| Molecular Formula | C20H14N4OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 6-(1-methylbenzimidazol-5-yl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cn1cnc2cc(-c3nc4sc(-c5ccccc5)cn4c3C=O)ccc21 |
| InChI | InChI=1S/C20H14N4OS/c1-23-12-21-15-9-14(7-8-16(15)23)19-17(11-25)24-10-18(26-20(24)22-19)13-5-3-2-4-6-13/h2-12H,1H3 |
| InChIKey | QVYJEBHIKYNFQM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|