C18H10Cl2N2OS — CID 82367729
6-(2,4-dichlorophenyl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 82367729) has the molecular formula C18H10Cl2N2OS and a molecular weight of 373.26 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(2,4-dichlorophenyl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 82367729 |
| Molecular Formula | C18H10Cl2N2OS |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-2-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(Cl)cc2Cl)nc2sc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C18H10Cl2N2OS/c19-12-6-7-13(14(20)8-12)17-15(10-23)22-9-16(24-18(22)21-17)11-4-2-1-3-5-11/h1-10H |
| InChIKey | JIXVXIBRRCRYFF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|