C16H8Cl2N2OS2 — CID 39198748
3-(2,4-dichlorophenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198748) has the molecular formula C16H8Cl2N2OS2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(2,4-dichlorophenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198748 |
| Molecular Formula | C16H8Cl2N2OS2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2cccs2)nc2scc(-c3ccc(Cl)cc3Cl)n12 |
| InChI | InChI=1S/C16H8Cl2N2OS2/c17-9-3-4-10(11(18)6-9)13-8-23-16-19-15(12(7-21)20(13)16)14-2-1-5-22-14/h1-8H |
| InChIKey | KLNQUTLDJVQIEC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|