C17H9N3O3S2 — CID 39198772
3-(2-oxo-3H-1,3-benzoxazol-6-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198772) has the molecular formula C17H9N3O3S2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-(2-oxo-3H-1,3-benzoxazol-6-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(2-oxo-3H-1,3-benzoxazol-6-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198772 |
| Molecular Formula | C17H9N3O3S2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 3-(2-oxo-3H-1,3-benzoxazol-6-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2cccs2)nc2scc(-c3ccc4[nH]c(=O)oc4c3)n12 |
| InChI | InChI=1S/C17H9N3O3S2/c21-7-11-15(14-2-1-5-24-14)19-16-20(11)12(8-25-16)9-3-4-10-13(6-9)23-17(22)18-10/h1-8H,(H,18,22) |
| InChIKey | KQFFOXDHQWVZDV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|