C18H14N2O2S2 — CID 39198776
3-(2-ethoxyphenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198776) has the molecular formula C18H14N2O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(2-ethoxyphenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198776 |
| Molecular Formula | C18H14N2O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 3-(2-ethoxyphenyl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CCOc1ccccc1-c1csc2nc(-c3cccs3)c(C=O)n12 |
| InChI | InChI=1S/C18H14N2O2S2/c1-2-22-15-7-4-3-6-12(15)14-11-24-18-19-17(13(10-21)20(14)18)16-8-5-9-23-16/h3-11H,2H2,1H3 |
| InChIKey | JWDJVQMLAVINBF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|