C17H10N2O3S2 — CID 39198778
3-(1,3-benzodioxol-5-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198778) has the molecular formula C17H10N2O3S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198778 |
| Molecular Formula | C17H10N2O3S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6-thiophen-2-ylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2cccs2)nc2scc(-c3ccc4c(c3)OCO4)n12 |
| InChI | InChI=1S/C17H10N2O3S2/c20-7-11-16(15-2-1-5-23-15)18-17-19(11)12(8-24-17)10-3-4-13-14(6-10)22-9-21-13/h1-8H,9H2 |
| InChIKey | ZVQVXHIJKOTSET-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|