C17H20N4O — CID 82368194
3-N,2-dimethyl-3-N-(2-pyridin-4-ylethyl)-2H-1,4-benzoxazine-3,7-diamine (PubChem CID 82368194) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-N,2-dimethyl-3-N-(2-pyridin-4-ylethyl)-2H-1,4-benzoxazine-3,7-diamine.
| Compound Name | 3-N,2-dimethyl-3-N-(2-pyridin-4-ylethyl)-2H-1,4-benzoxazine-3,7-diamine |
|---|---|
| PubChem CID | 82368194 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-N,2-dimethyl-3-N-(2-pyridin-4-ylethyl)-2H-1,4-benzoxazine-3,7-diamine |
| SMILES | CC1Oc2cc(N)ccc2N=C1N(C)CCc1ccncc1 |
| InChI | InChI=1S/C17H20N4O/c1-12-17(20-15-4-3-14(18)11-16(15)22-12)21(2)10-7-13-5-8-19-9-6-13/h3-6,8-9,11-12H,7,10,18H2,1-2H3 |
| InChIKey | QDMXWEQJDVCXNV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|