C16H15FN4 — CID 82370210
5-(3,4-dimethylphenyl)-3-(4-fluorophenyl)triazol-4-amine (PubChem CID 82370210) has the molecular formula C16H15FN4 and a molecular weight of 282.32 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3-(4-fluorophenyl)triazol-4-amine.
| Compound Name | 5-(3,4-dimethylphenyl)-3-(4-fluorophenyl)triazol-4-amine |
|---|---|
| PubChem CID | 82370210 |
| Molecular Formula | C16H15FN4 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3-(4-fluorophenyl)triazol-4-amine |
| SMILES | Cc1ccc(-c2nnn(-c3ccc(F)cc3)c2N)cc1C |
| InChI | InChI=1S/C16H15FN4/c1-10-3-4-12(9-11(10)2)15-16(18)21(20-19-15)14-7-5-13(17)6-8-14/h3-9H,18H2,1-2H3 |
| InChIKey | QGMCMHCPVDXNFB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |