C11H9NO5S — CID 82372053
5-(benzenesulfonyl)-4,6-dihydroxy-1H-pyridin-2-one (PubChem CID 82372053) has the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-4,6-dihydroxy-1H-pyridin-2-one.
| Compound Name | 5-(benzenesulfonyl)-4,6-dihydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 82372053 |
| Molecular Formula | C11H9NO5S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 5-(benzenesulfonyl)-4,6-dihydroxy-1H-pyridin-2-one |
| SMILES | O=c1cc(O)c(S(=O)(=O)c2ccccc2)c(O)[nH]1 |
| InChI | InChI=1S/C11H9NO5S/c13-8-6-9(14)12-11(15)10(8)18(16,17)7-4-2-1-3-5-7/h1-6H,(H3,12,13,14,15) |
| InChIKey | XVEPOLUSTQJTKQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |