C12H13NO2 — CID 82373470
7-methoxy-3,4-dimethyl-1H-indole-2-carbaldehyde (PubChem CID 82373470) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 7-methoxy-3,4-dimethyl-1H-indole-2-carbaldehyde.
| Compound Name | 7-methoxy-3,4-dimethyl-1H-indole-2-carbaldehyde |
|---|---|
| PubChem CID | 82373470 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 7-methoxy-3,4-dimethyl-1H-indole-2-carbaldehyde |
| SMILES | COc1ccc(C)c2c(C)c(C=O)[nH]c12 |
| InChI | InChI=1S/C12H13NO2/c1-7-4-5-10(15-3)12-11(7)8(2)9(6-14)13-12/h4-6,13H,1-3H3 |
| InChIKey | JHZFLQOARBAADM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|