C12H14N2O3 — CID 172970685
4,7-dimethoxy-3-methyl-1H-indole-2-carboxamide (PubChem CID 172970685) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4,7-dimethoxy-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 4,7-dimethoxy-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 172970685 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4,7-dimethoxy-3-methyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc(OC)c2c(C)c(C(N)=O)[nH]c12 |
| InChI | InChI=1S/C12H14N2O3/c1-6-9-7(16-2)4-5-8(17-3)11(9)14-10(6)12(13)15/h4-5,14H,1-3H3,(H2,13,15) |
| InChIKey | TVTPIEFJRBHXLC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |