C11H9F3N2O2 — CID 175836718
4-methoxy-3-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 175836718) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 4-methoxy-3-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | 4-methoxy-3-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175836718 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-methoxy-3-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(N)=O)c(C(F)(F)F)c12 |
| InChI | InChI=1S/C11H9F3N2O2/c1-18-6-4-2-3-5-7(6)8(11(12,13)14)9(16-5)10(15)17/h2-4,16H,1H3,(H2,15,17) |
| InChIKey | VCMRMMOWEZNTME-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |