C12H13NO2 — CID 119083522
5-methoxy-2,3-dimethyl-1H-quinolin-4-one (PubChem CID 119083522) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-methoxy-2,3-dimethyl-1H-quinolin-4-one.
| Compound Name | 5-methoxy-2,3-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 119083522 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-methoxy-2,3-dimethyl-1H-quinolin-4-one |
| SMILES | COc1cccc2[nH]c(C)c(C)c(=O)c12 |
| InChI | InChI=1S/C12H13NO2/c1-7-8(2)13-9-5-4-6-10(15-3)11(9)12(7)14/h4-6H,1-3H3,(H,13,14) |
| InChIKey | NDICKKORDURBPV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |