C14H12N2O5 — CID 20977871
N-acetyl-3-formyl-5-methoxy-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 20977871) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-acetyl-3-formyl-5-methoxy-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | N-acetyl-3-formyl-5-methoxy-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20977871 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-acetyl-3-formyl-5-methoxy-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)NC(C)=O)c(C=O)c(=O)c12 |
| InChI | InChI=1S/C14H12N2O5/c1-7(18)15-14(20)12-8(6-17)13(19)11-9(16-12)4-3-5-10(11)21-2/h3-6H,1-2H3,(H,16,19)(H,15,18,20) |
| InChIKey | GNHUNXDOXCSPIK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|