C13H16N2O2 — CID 82495738
5,8-dimethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 82495738) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5,8-dimethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 5,8-dimethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 82495738 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5,8-dimethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc(OC)c2c3c([nH]c12)CNCC3 |
| InChI | InChI=1S/C13H16N2O2/c1-16-10-3-4-11(17-2)13-12(10)8-5-6-14-7-9(8)15-13/h3-4,14-15H,5-7H2,1-2H3 |
| InChIKey | MZJSHUCKRNUTRH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |