C13H15ClN2O — CID 83843758
5-chloro-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 83843758) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 5-chloro-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 5-chloro-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 83843758 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5-chloro-8-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | COc1ccc(Cl)c2c3c([nH]c12)CCC(N)C3 |
| InChI | InChI=1S/C13H15ClN2O/c1-17-11-5-3-9(14)12-8-6-7(15)2-4-10(8)16-13(11)12/h3,5,7,16H,2,4,6,15H2,1H3 |
| InChIKey | BUJZGWCYLZTQOX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |