C11H19N3 — CID 82373833
(4-tert-butyl-2-cyclopropyl-1H-imidazol-5-yl)methanamine (PubChem CID 82373833) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (4-tert-butyl-2-cyclopropyl-1H-imidazol-5-yl)methanamine.
| Compound Name | (4-tert-butyl-2-cyclopropyl-1H-imidazol-5-yl)methanamine |
|---|---|
| PubChem CID | 82373833 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (4-tert-butyl-2-cyclopropyl-1H-imidazol-5-yl)methanamine |
| SMILES | CC(C)(C)c1nc(C2CC2)[nH]c1CN |
| InChI | InChI=1S/C11H19N3/c1-11(2,3)9-8(6-12)13-10(14-9)7-4-5-7/h7H,4-6,12H2,1-3H3,(H,13,14) |
| InChIKey | FTUKDBFOCPSNDG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |