C9H15N3O — CID 96589936
[2-cyclopropyl-5-(methoxymethyl)-1H-imidazol-4-yl]methanamine (PubChem CID 96589936) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is [2-cyclopropyl-5-(methoxymethyl)-1H-imidazol-4-yl]methanamine.
| Compound Name | [2-cyclopropyl-5-(methoxymethyl)-1H-imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 96589936 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | [2-cyclopropyl-5-(methoxymethyl)-1H-imidazol-4-yl]methanamine |
| SMILES | COCc1[nH]c(C2CC2)nc1CN |
| InChI | InChI=1S/C9H15N3O/c1-13-5-8-7(4-10)11-9(12-8)6-2-3-6/h6H,2-5,10H2,1H3,(H,11,12) |
| InChIKey | UMCNDDZTQLICMT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |