C15H11NO3 — CID 82376002
5-methyl-4-phenylfuro[2,3-b]pyridine-2-carboxylic acid (PubChem CID 82376002) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 5-methyl-4-phenylfuro[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 5-methyl-4-phenylfuro[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 82376002 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-methyl-4-phenylfuro[2,3-b]pyridine-2-carboxylic acid |
| SMILES | Cc1cnc2oc(C(=O)O)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C15H11NO3/c1-9-8-16-14-11(7-12(19-14)15(17)18)13(9)10-5-3-2-4-6-10/h2-8H,1H3,(H,17,18) |
| InChIKey | QPDQKVSZDCIPLC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |