C14H11FN2O — CID 82376035
4-(4-fluorophenyl)-5-methylfuro[2,3-b]pyridin-3-amine (PubChem CID 82376035) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-methylfuro[2,3-b]pyridin-3-amine.
| Compound Name | 4-(4-fluorophenyl)-5-methylfuro[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 82376035 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-(4-fluorophenyl)-5-methylfuro[2,3-b]pyridin-3-amine |
| SMILES | Cc1cnc2occ(N)c2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11FN2O/c1-8-6-17-14-13(11(16)7-18-14)12(8)9-2-4-10(15)5-3-9/h2-7H,16H2,1H3 |
| InChIKey | DFOKQJNXTQJTDL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |