C15H15N3O — CID 82375408
4-(3,4-dimethylphenyl)-2-methylfuro[2,3-d]pyrimidin-5-amine (PubChem CID 82375408) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2-methylfuro[2,3-d]pyrimidin-5-amine.
| Compound Name | 4-(3,4-dimethylphenyl)-2-methylfuro[2,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 82375408 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2-methylfuro[2,3-d]pyrimidin-5-amine |
| SMILES | Cc1nc(-c2ccc(C)c(C)c2)c2c(N)coc2n1 |
| InChI | InChI=1S/C15H15N3O/c1-8-4-5-11(6-9(8)2)14-13-12(16)7-19-15(13)18-10(3)17-14/h4-7H,16H2,1-3H3 |
| InChIKey | UTEYBLBSVGDFOQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |