C15H15N3O — CID 82376081
4-(4-methoxy-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine (PubChem CID 82376081) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-(4-methoxy-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | 4-(4-methoxy-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 82376081 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-(4-methoxy-3-methylphenyl)-1H-pyrrolo[2,3-b]pyridin-3-amine |
| SMILES | COc1ccc(-c2ccnc3[nH]cc(N)c23)cc1C |
| InChI | InChI=1S/C15H15N3O/c1-9-7-10(3-4-13(9)19-2)11-5-6-17-15-14(11)12(16)8-18-15/h3-8H,16H2,1-2H3,(H,17,18) |
| InChIKey | NBSDPQNTQDWAAH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |