C23H23N3O3 — CID 173165419
4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-ethoxyaniline (PubChem CID 173165419) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-ethoxyaniline.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-ethoxyaniline |
|---|---|
| PubChem CID | 173165419 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-ethoxyaniline |
| SMILES | CCOc1cc(N)ccc1-c1ccnc2[nH]cc(-c3ccc(OC)c(OC)c3)c12 |
| InChI | InChI=1S/C23H23N3O3/c1-4-29-20-12-15(24)6-7-16(20)17-9-10-25-23-22(17)18(13-26-23)14-5-8-19(27-2)21(11-14)28-3/h5-13H,4,24H2,1-3H3,(H,25,26) |
| InChIKey | CTRGOHLNROKQAT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|