C11H11N3O2 — CID 82376279
1-[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]ethanone (PubChem CID 82376279) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]ethanone.
| Compound Name | 1-[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]ethanone |
|---|---|
| PubChem CID | 82376279 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]ethanone |
| SMILES | COc1ccc(-c2n[nH]c(C(C)=O)n2)cc1 |
| InChI | InChI=1S/C11H11N3O2/c1-7(15)10-12-11(14-13-10)8-3-5-9(16-2)6-4-8/h3-6H,1-2H3,(H,12,13,14) |
| InChIKey | IBBSARNHSWJGJX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |